C11H12ClN3O — CID 118992789
4-chloro-3-(oxan-4-yl)-2H-pyrazolo[4,3-c]pyridine (PubChem CID 118992789) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 4-chloro-3-(oxan-4-yl)-2H-pyrazolo[4,3-c]pyridine.
| Compound Name | 4-chloro-3-(oxan-4-yl)-2H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 118992789 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-chloro-3-(oxan-4-yl)-2H-pyrazolo[4,3-c]pyridine |
| SMILES | Clc1nccc2n[nH]c(C3CCOCC3)c12 |
| InChI | InChI=1S/C11H12ClN3O/c12-11-9-8(1-4-13-11)14-15-10(9)7-2-5-16-6-3-7/h1,4,7H,2-3,5-6H2,(H,14,15) |
| InChIKey | IEYUZYSUHJSCRP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|