C12H15NO5 — CID 118995107
oxalic acid;2,3,4,5-tetrahydro-1-benzoxepin-4-amine (PubChem CID 118995107) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is oxalic acid;2,3,4,5-tetrahydro-1-benzoxepin-4-amine.
| Compound Name | oxalic acid;2,3,4,5-tetrahydro-1-benzoxepin-4-amine |
|---|---|
| PubChem CID | 118995107 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | oxalic acid;2,3,4,5-tetrahydro-1-benzoxepin-4-amine |
| SMILES | NC1CCOc2ccccc2C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H13NO.C2H2O4/c11-9-5-6-12-10-4-2-1-3-8(10)7-9;3-1(4)2(5)6/h1-4,9H,5-7,11H2;(H,3,4)(H,5,6) |
| InChIKey | JWQDRUNEVFPSMY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|