C8H6F2N4O — CID 118995384
2-amino-6-cyano-3-(difluoromethyl)pyridine-4-carboxamide (PubChem CID 118995384) has the molecular formula C8H6F2N4O and a molecular weight of 212.16 g/mol. Its IUPAC name is 2-amino-6-cyano-3-(difluoromethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-cyano-3-(difluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118995384 |
| Molecular Formula | C8H6F2N4O |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-amino-6-cyano-3-(difluoromethyl)pyridine-4-carboxamide |
| SMILES | N#Cc1cc(C(N)=O)c(C(F)F)c(N)n1 |
| InChI | InChI=1S/C8H6F2N4O/c9-6(10)5-4(8(13)15)1-3(2-11)14-7(5)12/h1,6H,(H2,12,14)(H2,13,15) |
| InChIKey | KRBLBPPRFRUDFR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |