C21H18ClN5O2 — CID 11899546
(8R,8aR)-8-(6-chloro-1,3-benzodioxol-5-yl)-2-ethyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 11899546) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is (8R,8aR)-8-(6-chloro-1,3-benzodioxol-5-yl)-2-ethyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-8-(6-chloro-1,3-benzodioxol-5-yl)-2-ethyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11899546 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (8R,8aR)-8-(6-chloro-1,3-benzodioxol-5-yl)-2-ethyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CCN(CC)C[C@@H]2[C@@H](c2cc3c(cc2Cl)OCO3)C1(C#N)C#N |
| InChI | InChI=1S/C21H18ClN5O2/c1-2-27-4-3-12-14(7-23)20(26)21(9-24,10-25)19(15(12)8-27)13-5-17-18(6-16(13)22)29-11-28-17/h3,5-6,14-15,19,26H,2,4,8,11H2,1H3/b26-20+/t14?,15-,19+/m0/s1 |
| InChIKey | GOROYZCVHQRXPG-IFIOJRBTSA-N |
| XLogP | 3.24 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|