C7H4F2I2O — CID 118999286
3-(difluoromethyl)-2,6-diiodophenol (PubChem CID 118999286) has the molecular formula C7H4F2I2O and a molecular weight of 395.91 g/mol. Its IUPAC name is 3-(difluoromethyl)-2,6-diiodophenol.
| Compound Name | 3-(difluoromethyl)-2,6-diiodophenol |
|---|---|
| PubChem CID | 118999286 |
| Molecular Formula | C7H4F2I2O |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.83 |
| IUPAC Name | 3-(difluoromethyl)-2,6-diiodophenol |
| SMILES | Oc1c(I)ccc(C(F)F)c1I |
| InChI | InChI=1S/C7H4F2I2O/c8-7(9)3-1-2-4(10)6(12)5(3)11/h1-2,7,12H |
| InChIKey | GXAMYUWIPLZACB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|