C8H8BrF3N2O — CID 119004935
6-(bromomethyl)-3-methyl-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 119004935) has the molecular formula C8H8BrF3N2O and a molecular weight of 285.06 g/mol. Its IUPAC name is 6-(bromomethyl)-3-methyl-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | 6-(bromomethyl)-3-methyl-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 119004935 |
| Molecular Formula | C8H8BrF3N2O |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 6-(bromomethyl)-3-methyl-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | Cc1cc(OC(F)(F)F)c(CBr)nc1N |
| InChI | InChI=1S/C8H8BrF3N2O/c1-4-2-6(15-8(10,11)12)5(3-9)14-7(4)13/h2H,3H2,1H3,(H2,13,14) |
| InChIKey | QCAAHJKSEGKPER-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|