C5BrClF3N — CID 119021724
2-bromo-6-chloro-3,4,5-trifluoropyridine (PubChem CID 119021724) has the molecular formula C5BrClF3N and a molecular weight of 246.41 g/mol. Its IUPAC name is 2-bromo-6-chloro-3,4,5-trifluoropyridine.
| Compound Name | 2-bromo-6-chloro-3,4,5-trifluoropyridine |
|---|---|
| PubChem CID | 119021724 |
| Molecular Formula | C5BrClF3N |
| Molecular Weight | 246.41 g/mol |
| Exact Mass | 244.89 |
| IUPAC Name | 2-bromo-6-chloro-3,4,5-trifluoropyridine |
| SMILES | Fc1c(Cl)nc(Br)c(F)c1F |
| InChI | InChI=1S/C5BrClF3N/c6-4-2(9)1(8)3(10)5(7)11-4 |
| InChIKey | GIAHJAZGQHMFRF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|