C8Cl2F4N2 — CID 166067248
1,4-dichloro-5,6,7,8-tetrafluorophthalazine (PubChem CID 166067248) has the molecular formula C8Cl2F4N2 and a molecular weight of 271.00 g/mol. Its IUPAC name is 1,4-dichloro-5,6,7,8-tetrafluorophthalazine.
| Compound Name | 1,4-dichloro-5,6,7,8-tetrafluorophthalazine |
|---|---|
| PubChem CID | 166067248 |
| Molecular Formula | C8Cl2F4N2 |
| Molecular Weight | 271.00 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | 1,4-dichloro-5,6,7,8-tetrafluorophthalazine |
| SMILES | Fc1c(F)c(F)c2c(Cl)nnc(Cl)c2c1F |
| InChI | InChI=1S/C8Cl2F4N2/c9-7-1-2(8(10)16-15-7)4(12)6(14)5(13)3(1)11 |
| InChIKey | IXPNLVGSRUNYLZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.00 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|