C6H3Cl2IN4 — CID 146433847
4,7-dichloro-1-iodo-3-methylpyrazolo[4,5-d]pyridazine (PubChem CID 146433847) has the molecular formula C6H3Cl2IN4 and a molecular weight of 328.93 g/mol. Its IUPAC name is 4,7-dichloro-1-iodo-3-methylpyrazolo[4,5-d]pyridazine.
| Compound Name | 4,7-dichloro-1-iodo-3-methylpyrazolo[4,5-d]pyridazine |
|---|---|
| PubChem CID | 146433847 |
| Molecular Formula | C6H3Cl2IN4 |
| Molecular Weight | 328.93 g/mol |
| Exact Mass | 327.88 |
| IUPAC Name | 4,7-dichloro-1-iodo-3-methylpyrazolo[4,5-d]pyridazine |
| SMILES | Cc1nn(I)c2c(Cl)nnc(Cl)c12 |
| InChI | InChI=1S/C6H3Cl2IN4/c1-2-3-4(13(9)12-2)6(8)11-10-5(3)7/h1H3 |
| InChIKey | GKZDMBBUZMSSAY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.93 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|