C14H12ClN3O — CID 135823739
5-chloro-3,4-dimethyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135823739) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is 5-chloro-3,4-dimethyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 5-chloro-3,4-dimethyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135823739 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-chloro-3,4-dimethyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1nn(-c2ccccc2)c2[nH]c(=O)c(Cl)c(C)c12 |
| InChI | InChI=1S/C14H12ClN3O/c1-8-11-9(2)17-18(10-6-4-3-5-7-10)13(11)16-14(19)12(8)15/h3-7H,1-2H3,(H,16,19) |
| InChIKey | AAPXDZIFTZJFPD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |