C30H24N4O2 — CID 136716740
(11Z)-11-(1-anilinoethylidene)-3-methyl-5,12-diphenyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3-triene-8,10-dione (PubChem CID 136716740) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is (11Z)-11-(1-anilinoethylidene)-3-methyl-5,12-diphenyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3-triene-8,10-dione.
| Compound Name | (11Z)-11-(1-anilinoethylidene)-3-methyl-5,12-diphenyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3-triene-8,10-dione |
|---|---|
| PubChem CID | 136716740 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | (11Z)-11-(1-anilinoethylidene)-3-methyl-5,12-diphenyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3-triene-8,10-dione |
| SMILES | C/C(Nc1ccccc1)=C1/C(=O)c2c(c3c(C)nn(-c4ccccc4)c3[nH]c2=O)C1c1ccccc1 |
| InChI | InChI=1S/C30H24N4O2/c1-18(31-21-14-8-4-9-15-21)23-25(20-12-6-3-7-13-20)26-24-19(2)33-34(22-16-10-5-11-17-22)29(24)32-30(36)27(26)28(23)35/h3-17,25,31H,1-2H3,(H,32,36)/b23-18- |
| InChIKey | LDNQVOCGCDKVJM-NKFKGCMQSA-N |
| XLogP | 5.74 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|