C27H51N3S3 — CID 119026114
2,4,6-tris(octylsulfanyl)-1,3,5-triazine (PubChem CID 119026114) has the molecular formula C27H51N3S3 and a molecular weight of 513.93 g/mol. Its IUPAC name is 2,4,6-tris(octylsulfanyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(octylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 119026114 |
| Molecular Formula | C27H51N3S3 |
| Molecular Weight | 513.93 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 2,4,6-tris(octylsulfanyl)-1,3,5-triazine |
| SMILES | CCCCCCCCSc1nc(SCCCCCCCC)nc(SCCCCCCCC)n1 |
| InChI | InChI=1S/C27H51N3S3/c1-4-7-10-13-16-19-22-31-25-28-26(32-23-20-17-14-11-8-5-2)30-27(29-25)33-24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| InChIKey | WSLLPWMCVKFWMX-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.93 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|