C19H34ClN3S2 — CID 14533900
2-chloro-4,6-bis(octylsulfanyl)-1,3,5-triazine (PubChem CID 14533900) has the molecular formula C19H34ClN3S2 and a molecular weight of 404.09 g/mol. Its IUPAC name is 2-chloro-4,6-bis(octylsulfanyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(octylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 14533900 |
| Molecular Formula | C19H34ClN3S2 |
| Molecular Weight | 404.09 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-chloro-4,6-bis(octylsulfanyl)-1,3,5-triazine |
| SMILES | CCCCCCCCSc1nc(Cl)nc(SCCCCCCCC)n1 |
| InChI | InChI=1S/C19H34ClN3S2/c1-3-5-7-9-11-13-15-24-18-21-17(20)22-19(23-18)25-16-14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| InChIKey | XAOOAGGWWYTXPM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.09 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|