C10H14N2O — CID 119030367
6-ethyl-7,8-dihydro-5H-1,6-naphthyridin-3-ol (PubChem CID 119030367) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 6-ethyl-7,8-dihydro-5H-1,6-naphthyridin-3-ol.
| Compound Name | 6-ethyl-7,8-dihydro-5H-1,6-naphthyridin-3-ol |
|---|---|
| PubChem CID | 119030367 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 6-ethyl-7,8-dihydro-5H-1,6-naphthyridin-3-ol |
| SMILES | CCN1CCc2ncc(O)cc2C1 |
| InChI | InChI=1S/C10H14N2O/c1-2-12-4-3-10-8(7-12)5-9(13)6-11-10/h5-6,13H,2-4,7H2,1H3 |
| InChIKey | CHNYQKOLGJQBEZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |