C16H19ClN2O4S — CID 119032218
[4-(3-chlorobenzoyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 119032218) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is [4-(3-chlorobenzoyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | [4-(3-chlorobenzoyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 119032218 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [4-(3-chlorobenzoyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCN(C(=O)C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H19ClN2O4S/c17-14-3-1-2-12(10-14)15(20)18-5-7-19(8-6-18)16(21)13-4-9-24(22,23)11-13/h1-3,10,13H,4-9,11H2 |
| InChIKey | MCJYFYXTQLIYGW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |