C20H18FNO3S — CID 119032734
5-(4-fluorophenyl)-N-[2-methyl-3-(methylsulfinylmethyl)phenyl]furan-2-carboxamide (PubChem CID 119032734) has the molecular formula C20H18FNO3S and a molecular weight of 371.43 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[2-methyl-3-(methylsulfinylmethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[2-methyl-3-(methylsulfinylmethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119032734 |
| Molecular Formula | C20H18FNO3S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[2-methyl-3-(methylsulfinylmethyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1c(CS(C)=O)cccc1NC(=O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H18FNO3S/c1-13-15(12-26(2)24)4-3-5-17(13)22-20(23)19-11-10-18(25-19)14-6-8-16(21)9-7-14/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | RESLIIKYLIJSGF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |