C18H22N2O3S — CID 119034707
1-(4-hydroxy-2,3,5-trimethylphenyl)-3-[2-(methylsulfinylmethyl)phenyl]urea (PubChem CID 119034707) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-(4-hydroxy-2,3,5-trimethylphenyl)-3-[2-(methylsulfinylmethyl)phenyl]urea.
| Compound Name | 1-(4-hydroxy-2,3,5-trimethylphenyl)-3-[2-(methylsulfinylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 119034707 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-(4-hydroxy-2,3,5-trimethylphenyl)-3-[2-(methylsulfinylmethyl)phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2ccccc2CS(C)=O)c(C)c(C)c1O |
| InChI | InChI=1S/C18H22N2O3S/c1-11-9-16(12(2)13(3)17(11)21)20-18(22)19-15-8-6-5-7-14(15)10-24(4)23/h5-9,21H,10H2,1-4H3,(H2,19,20,22) |
| InChIKey | MEZIBBTWLANXEL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|