C18H16N2O3S — CID 119043976
N-(3-ethynylphenyl)-N'-[2-(methylsulfinylmethyl)phenyl]oxamide (PubChem CID 119043976) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-N'-[2-(methylsulfinylmethyl)phenyl]oxamide.
| Compound Name | N-(3-ethynylphenyl)-N'-[2-(methylsulfinylmethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 119043976 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-(3-ethynylphenyl)-N'-[2-(methylsulfinylmethyl)phenyl]oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)Nc2ccccc2CS(C)=O)c1 |
| InChI | InChI=1S/C18H16N2O3S/c1-3-13-7-6-9-15(11-13)19-17(21)18(22)20-16-10-5-4-8-14(16)12-24(2)23/h1,4-11H,12H2,2H3,(H,19,21)(H,20,22) |
| InChIKey | RGMXQTWPCXFBCN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|