C17H13FN2O3 — CID 99584775
N-(3-ethynylphenyl)-N'-(2-fluoro-5-methoxyphenyl)oxamide (PubChem CID 99584775) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-N'-(2-fluoro-5-methoxyphenyl)oxamide.
| Compound Name | N-(3-ethynylphenyl)-N'-(2-fluoro-5-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 99584775 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(3-ethynylphenyl)-N'-(2-fluoro-5-methoxyphenyl)oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)Nc2cc(OC)ccc2F)c1 |
| InChI | InChI=1S/C17H13FN2O3/c1-3-11-5-4-6-12(9-11)19-16(21)17(22)20-15-10-13(23-2)7-8-14(15)18/h1,4-10H,2H3,(H,19,21)(H,20,22) |
| InChIKey | QNDGUDXHUYJPQC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|