C22H31N3O5S — CID 1190364
[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone (PubChem CID 1190364) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is [1-(2-nitrophenyl)sulfonylpiperidin-4-yl]-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone.
| Compound Name | [1-(2-nitrophenyl)sulfonylpiperidin-4-yl]-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
|---|---|
| PubChem CID | 1190364 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [1-(2-nitrophenyl)sulfonylpiperidin-4-yl]-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2C(=O)C2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C22H31N3O5S/c1-21(2)12-17-13-22(3,14-21)15-24(17)20(26)16-8-10-23(11-9-16)31(29,30)19-7-5-4-6-18(19)25(27)28/h4-7,16-17H,8-15H2,1-3H3/t17-,22-/m0/s1 |
| InChIKey | STBMWAAWDGFORN-JTSKRJEESA-N |
| XLogP | 3.42 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|