C19H21NO2S — CID 119037635
N-(2-methylsulfinyl-1-phenylethyl)-2,3-dihydro-1H-indene-4-carboxamide (PubChem CID 119037635) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-(2-methylsulfinyl-1-phenylethyl)-2,3-dihydro-1H-indene-4-carboxamide.
| Compound Name | N-(2-methylsulfinyl-1-phenylethyl)-2,3-dihydro-1H-indene-4-carboxamide |
|---|---|
| PubChem CID | 119037635 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(2-methylsulfinyl-1-phenylethyl)-2,3-dihydro-1H-indene-4-carboxamide |
| SMILES | CS(=O)CC(NC(=O)c1cccc2c1CCC2)c1ccccc1 |
| InChI | InChI=1S/C19H21NO2S/c1-23(22)13-18(15-7-3-2-4-8-15)20-19(21)17-12-6-10-14-9-5-11-16(14)17/h2-4,6-8,10,12,18H,5,9,11,13H2,1H3,(H,20,21) |
| InChIKey | FNZDOLIUJAVYJH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |