C17H22N2O3S — CID 119037829
N-[4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 119037829) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 119037829 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CC2CC3CC2C1C3O)c1ccsc1 |
| InChI | InChI=1S/C17H22N2O3S/c20-14(2-1-4-18-17(22)10-3-5-23-9-10)19-8-12-6-11-7-13(12)15(19)16(11)21/h3,5,9,11-13,15-16,21H,1-2,4,6-8H2,(H,18,22) |
| InChIKey | VUMMTHNVVPMJME-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|