C17H22N2O3S2 — CID 119037881
2-[3-(3-ethoxypiperidin-1-yl)sulfonylphenyl]-4-methyl-1,3-thiazole (PubChem CID 119037881) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[3-(3-ethoxypiperidin-1-yl)sulfonylphenyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[3-(3-ethoxypiperidin-1-yl)sulfonylphenyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 119037881 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[3-(3-ethoxypiperidin-1-yl)sulfonylphenyl]-4-methyl-1,3-thiazole |
| SMILES | CCOC1CCCN(S(=O)(=O)c2cccc(-c3nc(C)cs3)c2)C1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-3-22-15-7-5-9-19(11-15)24(20,21)16-8-4-6-14(10-16)17-18-13(2)12-23-17/h4,6,8,10,12,15H,3,5,7,9,11H2,1-2H3 |
| InChIKey | RDLMSDKKOFEJIG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |