C20H28N2O3 — CID 119038618
(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl 4-(diethylaminomethyl)benzoate (PubChem CID 119038618) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl 4-(diethylaminomethyl)benzoate.
| Compound Name | (1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl 4-(diethylaminomethyl)benzoate |
|---|---|
| PubChem CID | 119038618 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl 4-(diethylaminomethyl)benzoate |
| SMILES | CCN(CC)Cc1ccc(C(=O)OCC2CC(=O)N(C3CC3)C2)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-3-21(4-2)12-15-5-7-17(8-6-15)20(24)25-14-16-11-19(23)22(13-16)18-9-10-18/h5-8,16,18H,3-4,9-14H2,1-2H3 |
| InChIKey | KLYDMOJUAXQUKI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |