C17H16FNO4 — CID 99607288
[(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 5-fluoro-1-benzofuran-2-carboxylate (PubChem CID 99607288) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is [(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 5-fluoro-1-benzofuran-2-carboxylate.
| Compound Name | [(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 5-fluoro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 99607288 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(3S)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 5-fluoro-1-benzofuran-2-carboxylate |
| SMILES | O=C(OC[C@H]1CC(=O)N(C2CC2)C1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C17H16FNO4/c18-12-1-4-14-11(6-12)7-15(23-14)17(21)22-9-10-5-16(20)19(8-10)13-2-3-13/h1,4,6-7,10,13H,2-3,5,8-9H2/t10-/m0/s1 |
| InChIKey | HSMJVIAIDSTYEM-JTQLQIEISA-N |
| XLogP | 2.74 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |