About [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate
[(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate (PubChem CID 99800520) has the molecular formula C16H18INO3
and a molecular weight of 399.23 g/mol. Its IUPAC name is [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate.
Molecular Properties
| Compound Name | [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate |
| PubChem CID | 99800520 |
| Molecular Formula | C16H18INO3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate |
| SMILES | O=C(Cc1ccc(I)cc1)OC[C@@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C16H18INO3/c17-13-3-1-11(2-4-13)8-16(20)21-10-12-7-15(19)18(9-12)14-5-6-14/h1-4,12,14H,5-10H2/t12-/m1/s1 |
| InChIKey | JQZIFXXZBHVBEQ-GFCCVEGCSA-N |
| XLogP | 2.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate?
The IUPAC name of [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate (CID 99800520) is [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate.
What is the SMILES notation for [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate?
The canonical SMILES for [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate is O=C(Cc1ccc(I)cc1)OC[C@@H]1CC(=O)N(C2CC2)C1.
What is the InChIKey of [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate?
The InChIKey is JQZIFXXZBHVBEQ-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H18INO3/c17-13-3-1-11(2-4-13)8-16(20)21-10-12-7-15(19)18(9-12)14-5-6-14/h1-4,12,14H,5-10H2/t12-/m1/s1.
What are the key properties of [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate?
[(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate has a molecular weight of 399.23 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-cyclopropyl-5-oxopyrrolidin-3-yl]methyl 2-(4-iodophenyl)acetate is sourced from PubChem (CID 99800520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).