C17H21N5O4 — CID 119039007
methyl 3-nitro-4-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]benzoate (PubChem CID 119039007) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is methyl 3-nitro-4-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]benzoate.
| Compound Name | methyl 3-nitro-4-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]benzoate |
|---|---|
| PubChem CID | 119039007 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | methyl 3-nitro-4-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC2CCc3nc(C(C)C)nn3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N5O4/c1-10(2)16-19-15-7-5-12(9-21(15)20-16)18-13-6-4-11(17(23)26-3)8-14(13)22(24)25/h4,6,8,10,12,18H,5,7,9H2,1-3H3 |
| InChIKey | BSLJFLGXHIDATC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|