C16H28N4OS — CID 119039603
N,N-dimethyl-4-[[5-methyl-4-(3-methylcyclohexyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 119039603) has the molecular formula C16H28N4OS and a molecular weight of 324.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[[5-methyl-4-(3-methylcyclohexyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N,N-dimethyl-4-[[5-methyl-4-(3-methylcyclohexyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 119039603 |
| Molecular Formula | C16H28N4OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N,N-dimethyl-4-[[5-methyl-4-(3-methylcyclohexyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | Cc1nnc(SCCCC(=O)N(C)C)n1C1CCCC(C)C1 |
| InChI | InChI=1S/C16H28N4OS/c1-12-7-5-8-14(11-12)20-13(2)17-18-16(20)22-10-6-9-15(21)19(3)4/h12,14H,5-11H2,1-4H3 |
| InChIKey | NQXCDHDXAWKWFJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|