C19H22ClN3O2 — CID 119039955
2-chloro-N-[2-[(3-methyl-2-pyridin-2-ylbutanoyl)amino]ethyl]benzamide (PubChem CID 119039955) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 2-chloro-N-[2-[(3-methyl-2-pyridin-2-ylbutanoyl)amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[(3-methyl-2-pyridin-2-ylbutanoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 119039955 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-chloro-N-[2-[(3-methyl-2-pyridin-2-ylbutanoyl)amino]ethyl]benzamide |
| SMILES | CC(C)C(C(=O)NCCNC(=O)c1ccccc1Cl)c1ccccn1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-13(2)17(16-9-5-6-10-21-16)19(25)23-12-11-22-18(24)14-7-3-4-8-15(14)20/h3-10,13,17H,11-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | UHHSEMBOCQSPJB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|