C14H19Cl2NO4 — CID 119040450
2-(2,3-dichlorophenoxy)-N-(1,5-dihydroxypentan-2-yl)propanamide (PubChem CID 119040450) has the molecular formula C14H19Cl2NO4 and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)-N-(1,5-dihydroxypentan-2-yl)propanamide.
| Compound Name | 2-(2,3-dichlorophenoxy)-N-(1,5-dihydroxypentan-2-yl)propanamide |
|---|---|
| PubChem CID | 119040450 |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-(2,3-dichlorophenoxy)-N-(1,5-dihydroxypentan-2-yl)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1Cl)C(=O)NC(CO)CCCO |
| InChI | InChI=1S/C14H19Cl2NO4/c1-9(14(20)17-10(8-19)4-3-7-18)21-12-6-2-5-11(15)13(12)16/h2,5-6,9-10,18-19H,3-4,7-8H2,1H3,(H,17,20) |
| InChIKey | QJFAYUAOCONVQH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |