C14H13Cl2N3O2 — CID 119040523
N-(1-cyanocyclopropyl)-3-(3,4-dichlorophenyl)-2-formamidopropanamide (PubChem CID 119040523) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-3-(3,4-dichlorophenyl)-2-formamidopropanamide.
| Compound Name | N-(1-cyanocyclopropyl)-3-(3,4-dichlorophenyl)-2-formamidopropanamide |
|---|---|
| PubChem CID | 119040523 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-(1-cyanocyclopropyl)-3-(3,4-dichlorophenyl)-2-formamidopropanamide |
| SMILES | N#CC1(NC(=O)C(Cc2ccc(Cl)c(Cl)c2)NC=O)CC1 |
| InChI | InChI=1S/C14H13Cl2N3O2/c15-10-2-1-9(5-11(10)16)6-12(18-8-20)13(21)19-14(7-17)3-4-14/h1-2,5,8,12H,3-4,6H2,(H,18,20)(H,19,21) |
| InChIKey | ONKWBKDRUJYVTP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|