C10H11Cl2NO — CID 171093295
N-[(2R)-1-(3,4-dichlorophenyl)propan-2-yl]formamide (PubChem CID 171093295) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is N-[(2R)-1-(3,4-dichlorophenyl)propan-2-yl]formamide.
| Compound Name | N-[(2R)-1-(3,4-dichlorophenyl)propan-2-yl]formamide |
|---|---|
| PubChem CID | 171093295 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | N-[(2R)-1-(3,4-dichlorophenyl)propan-2-yl]formamide |
| SMILES | C[C@H](Cc1ccc(Cl)c(Cl)c1)NC=O |
| InChI | InChI=1S/C10H11Cl2NO/c1-7(13-6-14)4-8-2-3-9(11)10(12)5-8/h2-3,5-7H,4H2,1H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | SBQCQMFYISAFPX-SSDOTTSWSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|