C15H18Cl2N2O3 — CID 124729956
N-[(2R)-3-(3,4-dichlorophenyl)-1-[(3S)-3-methylmorpholin-4-yl]-1-oxopropan-2-yl]formamide (PubChem CID 124729956) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is N-[(2R)-3-(3,4-dichlorophenyl)-1-[(3S)-3-methylmorpholin-4-yl]-1-oxopropan-2-yl]formamide.
| Compound Name | N-[(2R)-3-(3,4-dichlorophenyl)-1-[(3S)-3-methylmorpholin-4-yl]-1-oxopropan-2-yl]formamide |
|---|---|
| PubChem CID | 124729956 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[(2R)-3-(3,4-dichlorophenyl)-1-[(3S)-3-methylmorpholin-4-yl]-1-oxopropan-2-yl]formamide |
| SMILES | C[C@H]1COCCN1C(=O)[C@@H](Cc1ccc(Cl)c(Cl)c1)NC=O |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-10-8-22-5-4-19(10)15(21)14(18-9-20)7-11-2-3-12(16)13(17)6-11/h2-3,6,9-10,14H,4-5,7-8H2,1H3,(H,18,20)/t10-,14+/m0/s1 |
| InChIKey | GVDMRCATLLOAPF-IINYFYTJSA-N |
| XLogP | 1.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|