C13H17Cl2NO2 — CID 175095485
3-(3,4-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxyamino]propanal (PubChem CID 175095485) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxyamino]propanal.
| Compound Name | 3-(3,4-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxyamino]propanal |
|---|---|
| PubChem CID | 175095485 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxyamino]propanal |
| SMILES | CC(C)(C)ONC(C=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-13(2,3)18-16-10(8-17)6-9-4-5-11(14)12(15)7-9/h4-5,7-8,10,16H,6H2,1-3H3 |
| InChIKey | YBWAYVMKFHHNQC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|