C20H28FN5O — CID 119049557
N-tert-butyl-2-[4-[[(8-fluoroquinazolin-4-yl)amino]methyl]piperidin-1-yl]acetamide (PubChem CID 119049557) has the molecular formula C20H28FN5O and a molecular weight of 373.48 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[(8-fluoroquinazolin-4-yl)amino]methyl]piperidin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[[(8-fluoroquinazolin-4-yl)amino]methyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 119049557 |
| Molecular Formula | C20H28FN5O |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | N-tert-butyl-2-[4-[[(8-fluoroquinazolin-4-yl)amino]methyl]piperidin-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCC(CNc2ncnc3c(F)cccc23)CC1 |
| InChI | InChI=1S/C20H28FN5O/c1-20(2,3)25-17(27)12-26-9-7-14(8-10-26)11-22-19-15-5-4-6-16(21)18(15)23-13-24-19/h4-6,13-14H,7-12H2,1-3H3,(H,25,27)(H,22,23,24) |
| InChIKey | OWZYPQDHEORYMK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |