C17H17N5O3 — CID 119049731
N-(2-cyano-3,4-dihydro-1H-naphthalen-2-yl)-5-ethyl-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 119049731) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is N-(2-cyano-3,4-dihydro-1H-naphthalen-2-yl)-5-ethyl-4-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-cyano-3,4-dihydro-1H-naphthalen-2-yl)-5-ethyl-4-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119049731 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(2-cyano-3,4-dihydro-1H-naphthalen-2-yl)-5-ethyl-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)NC2(C#N)CCc3ccccc3C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N5O3/c1-2-13-15(22(24)25)14(21-20-13)16(23)19-17(10-18)8-7-11-5-3-4-6-12(11)9-17/h3-6H,2,7-9H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | GFHNDEXEKAGRCZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|