C16H19N3OS — CID 119051627
[3-(4-ethylphenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 119051627) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is [3-(4-ethylphenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [3-(4-ethylphenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 119051627 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [3-(4-ethylphenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | CCc1ccc(C2CN(C(=O)c3cscn3)CCN2)cc1 |
| InChI | InChI=1S/C16H19N3OS/c1-2-12-3-5-13(6-4-12)14-9-19(8-7-17-14)16(20)15-10-21-11-18-15/h3-6,10-11,14,17H,2,7-9H2,1H3 |
| InChIKey | VNKMKNCBWUNHQF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |