C11H14ClN3 — CID 119053925
6-tert-butyl-4-chloro-1-methylpyrazolo[5,4-b]pyridine (PubChem CID 119053925) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 6-tert-butyl-4-chloro-1-methylpyrazolo[5,4-b]pyridine.
| Compound Name | 6-tert-butyl-4-chloro-1-methylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 119053925 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 6-tert-butyl-4-chloro-1-methylpyrazolo[5,4-b]pyridine |
| SMILES | Cn1ncc2c(Cl)cc(C(C)(C)C)nc21 |
| InChI | InChI=1S/C11H14ClN3/c1-11(2,3)9-5-8(12)7-6-13-15(4)10(7)14-9/h5-6H,1-4H3 |
| InChIKey | HJKKNAXCOXMITK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |