C8H17Cl2F3N2 — CID 119057017
1-ethyl-4-(trifluoromethyl)piperidin-4-amine;dihydrochloride (PubChem CID 119057017) has the molecular formula C8H17Cl2F3N2 and a molecular weight of 269.14 g/mol. Its IUPAC name is 1-ethyl-4-(trifluoromethyl)piperidin-4-amine;dihydrochloride.
| Compound Name | 1-ethyl-4-(trifluoromethyl)piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 119057017 |
| Molecular Formula | C8H17Cl2F3N2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-ethyl-4-(trifluoromethyl)piperidin-4-amine;dihydrochloride |
| SMILES | CCN1CCC(N)(C(F)(F)F)CC1.Cl.Cl |
| InChI | InChI=1S/C8H15F3N2.2ClH/c1-2-13-5-3-7(12,4-6-13)8(9,10)11;;/h2-6,12H2,1H3;2*1H |
| InChIKey | OOHIVGVWPJJDKJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |