C16H26N4O3 — CID 119060055
2-[[4-[methyl(oxan-4-yl)amino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol (PubChem CID 119060055) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[[4-[methyl(oxan-4-yl)amino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[methyl(oxan-4-yl)amino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 119060055 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2-[[4-[methyl(oxan-4-yl)amino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
| SMILES | CN(c1cc(C2CCOC2)nc(NCCO)n1)C1CCOCC1 |
| InChI | InChI=1S/C16H26N4O3/c1-20(13-3-8-22-9-4-13)15-10-14(12-2-7-23-11-12)18-16(19-15)17-5-6-21/h10,12-13,21H,2-9,11H2,1H3,(H,17,18,19) |
| InChIKey | RHQCRXALCHQCRI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |