C18H24N4O3 — CID 119073055
3-[[[2-(2-hydroxyethylamino)-6-(oxolan-3-yl)pyrimidin-4-yl]-methylamino]methyl]phenol (PubChem CID 119073055) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[[[2-(2-hydroxyethylamino)-6-(oxolan-3-yl)pyrimidin-4-yl]-methylamino]methyl]phenol.
| Compound Name | 3-[[[2-(2-hydroxyethylamino)-6-(oxolan-3-yl)pyrimidin-4-yl]-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 119073055 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[[[2-(2-hydroxyethylamino)-6-(oxolan-3-yl)pyrimidin-4-yl]-methylamino]methyl]phenol |
| SMILES | CN(Cc1cccc(O)c1)c1cc(C2CCOC2)nc(NCCO)n1 |
| InChI | InChI=1S/C18H24N4O3/c1-22(11-13-3-2-4-15(24)9-13)17-10-16(14-5-8-25-12-14)20-18(21-17)19-6-7-23/h2-4,9-10,14,23-24H,5-8,11-12H2,1H3,(H,19,20,21) |
| InChIKey | GISHXCZEECINAW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |