C17H23N5O2 — CID 126437837
2-[[4-[methyl(pyridin-3-ylmethyl)amino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol (PubChem CID 126437837) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[[4-[methyl(pyridin-3-ylmethyl)amino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[methyl(pyridin-3-ylmethyl)amino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 126437837 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-[[4-[methyl(pyridin-3-ylmethyl)amino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
| SMILES | CN(Cc1cccnc1)c1cc([C@H]2CCOC2)nc(NCCO)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-22(11-13-3-2-5-18-10-13)16-9-15(14-4-8-24-12-14)20-17(21-16)19-6-7-23/h2-3,5,9-10,14,23H,4,6-8,11-12H2,1H3,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | URWHPARYAYATFV-AWEZNQCLSA-N |
| XLogP | 1.42 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |