C18H29N5O — CID 119061021
4-(4-cyclopentyl-1,4-diazepan-1-yl)-6-(oxolan-3-yl)pyrimidin-2-amine (PubChem CID 119061021) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-(4-cyclopentyl-1,4-diazepan-1-yl)-6-(oxolan-3-yl)pyrimidin-2-amine.
| Compound Name | 4-(4-cyclopentyl-1,4-diazepan-1-yl)-6-(oxolan-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 119061021 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 4-(4-cyclopentyl-1,4-diazepan-1-yl)-6-(oxolan-3-yl)pyrimidin-2-amine |
| SMILES | Nc1nc(C2CCOC2)cc(N2CCCN(C3CCCC3)CC2)n1 |
| InChI | InChI=1S/C18H29N5O/c19-18-20-16(14-6-11-24-13-14)12-17(21-18)23-8-3-7-22(9-10-23)15-4-1-2-5-15/h12,14-15H,1-11,13H2,(H2,19,20,21) |
| InChIKey | CAWMDUGFKIJIQK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |