C17H20N2O2S — CID 119064011
1-cyclopropyl-3-(furan-3-ylmethyl)-1-[(4-methylsulfanylphenyl)methyl]urea (PubChem CID 119064011) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-cyclopropyl-3-(furan-3-ylmethyl)-1-[(4-methylsulfanylphenyl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-(furan-3-ylmethyl)-1-[(4-methylsulfanylphenyl)methyl]urea |
|---|---|
| PubChem CID | 119064011 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-cyclopropyl-3-(furan-3-ylmethyl)-1-[(4-methylsulfanylphenyl)methyl]urea |
| SMILES | CSc1ccc(CN(C(=O)NCc2ccoc2)C2CC2)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-22-16-6-2-13(3-7-16)11-19(15-4-5-15)17(20)18-10-14-8-9-21-12-14/h2-3,6-9,12,15H,4-5,10-11H2,1H3,(H,18,20) |
| InChIKey | PJBRALUXVWSLKN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |