C13H17N5O2 — CID 138023096
1-cyclopropyl-1-(furan-3-ylmethyl)-3-[(1-methyltriazol-4-yl)methyl]urea (PubChem CID 138023096) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-cyclopropyl-1-(furan-3-ylmethyl)-3-[(1-methyltriazol-4-yl)methyl]urea.
| Compound Name | 1-cyclopropyl-1-(furan-3-ylmethyl)-3-[(1-methyltriazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 138023096 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-cyclopropyl-1-(furan-3-ylmethyl)-3-[(1-methyltriazol-4-yl)methyl]urea |
| SMILES | Cn1cc(CNC(=O)N(Cc2ccoc2)C2CC2)nn1 |
| InChI | InChI=1S/C13H17N5O2/c1-17-8-11(15-16-17)6-14-13(19)18(12-2-3-12)7-10-4-5-20-9-10/h4-5,8-9,12H,2-3,6-7H2,1H3,(H,14,19) |
| InChIKey | JSIHGKFUPULZIC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |