C22H19F3NO2- — CID 11906507
(1S,2S,10R,11R,12R)-10-[3-(trifluoromethyl)phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate (PubChem CID 11906507) has the molecular formula C22H19F3NO2- and a molecular weight of 386.39 g/mol. Its IUPAC name is (1S,2S,10R,11R,12R)-10-[3-(trifluoromethyl)phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate.
| Compound Name | (1S,2S,10R,11R,12R)-10-[3-(trifluoromethyl)phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate |
|---|---|
| PubChem CID | 11906507 |
| Molecular Formula | C22H19F3NO2- |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (1S,2S,10R,11R,12R)-10-[3-(trifluoromethyl)phenyl]-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate |
| SMILES | O=C([O-])c1cccc2c1N[C@@H](c1cccc(C(F)(F)F)c1)[C@@H]1[C@@H]3CC[C@@H](C3)[C@H]21 |
| InChI | InChI=1S/C22H20F3NO2/c23-22(24,25)14-4-1-3-13(10-14)19-18-12-8-7-11(9-12)17(18)15-5-2-6-16(21(27)28)20(15)26-19/h1-6,10-12,17-19,26H,7-9H2,(H,27,28)/p-1/t11-,12+,17+,18+,19-/m0/s1 |
| InChIKey | MTSJXIFTQHGXLS-JVSQDISJSA-M |
| XLogP | 4.37 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |