C22H28N4O2 — CID 119065860
4-[(2S)-2,6-diaminohexanoyl]-1-(2-phenylphenyl)piperazin-2-one (PubChem CID 119065860) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-[(2S)-2,6-diaminohexanoyl]-1-(2-phenylphenyl)piperazin-2-one.
| Compound Name | 4-[(2S)-2,6-diaminohexanoyl]-1-(2-phenylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 119065860 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-[(2S)-2,6-diaminohexanoyl]-1-(2-phenylphenyl)piperazin-2-one |
| SMILES | NCCCC[C@H](N)C(=O)N1CCN(c2ccccc2-c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C22H28N4O2/c23-13-7-6-11-19(24)22(28)25-14-15-26(21(27)16-25)20-12-5-4-10-18(20)17-8-2-1-3-9-17/h1-5,8-10,12,19H,6-7,11,13-16,23-24H2/t19-/m0/s1 |
| InChIKey | HHPGRHYXYPQINQ-IBGZPJMESA-N |
| XLogP | 1.99 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|