C18H19F3N2O3 — CID 119068027
N-(furan-2-ylmethyl)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 119068027) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119068027 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccco1)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H19F3N2O3/c19-18(20,21)14-4-1-3-13(11-14)17(25)6-8-23(9-7-17)16(24)22-12-15-5-2-10-26-15/h1-5,10-11,25H,6-9,12H2,(H,22,24) |
| InChIKey | OSZPHVGBLSXKLN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |