C21H30N2O3 — CID 11906825
2-[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxy-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone (PubChem CID 11906825) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxy-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone.
| Compound Name | 2-[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxy-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 11906825 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 2-[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxy-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
| SMILES | COc1ccc(/C(C)=N\OCC(=O)N2C[C@@]3(C)C[C@@H]2CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C21H30N2O3/c1-15(16-6-8-18(25-5)9-7-16)22-26-12-19(24)23-14-21(4)11-17(23)10-20(2,3)13-21/h6-9,17H,10-14H2,1-5H3/b22-15-/t17-,21-/m0/s1 |
| InChIKey | YTQJQMDUOCLHHT-MLDXBRNASA-N |
| XLogP | 3.86 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|