C20H26F2N2O3 — CID 50930549
2-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone (PubChem CID 50930549) has the molecular formula C20H26F2N2O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone.
| Compound Name | 2-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 50930549 |
| Molecular Formula | C20H26F2N2O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(CN2C(=O)CO/N=C\c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C20H26F2N2O3/c1-19(2)8-15-9-20(3,12-19)13-24(15)17(25)11-26-23-10-14-4-6-16(7-5-14)27-18(21)22/h4-7,10,15,18H,8-9,11-13H2,1-3H3/b23-10-/t15-,20+/m1/s1 |
| InChIKey | PYAYWCJDXQXNSX-JQDIHAQVSA-N |
| XLogP | 4.07 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|